C20H25N3OS — CID 39197518
[3-tert-butyl-6-[4-(2-methylprop-2-enoxy)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methanamine (PubChem CID 39197518) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is [3-tert-butyl-6-[4-(2-methylprop-2-enoxy)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methanamine.
| Compound Name | [3-tert-butyl-6-[4-(2-methylprop-2-enoxy)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 39197518 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | [3-tert-butyl-6-[4-(2-methylprop-2-enoxy)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methanamine |
| SMILES | C=C(C)COc1ccc(-c2nc3scc(C(C)(C)C)n3c2CN)cc1 |
| InChI | InChI=1S/C20H25N3OS/c1-13(2)11-24-15-8-6-14(7-9-15)18-16(10-21)23-17(20(3,4)5)12-25-19(23)22-18/h6-9,12H,1,10-11,21H2,2-5H3 |
| InChIKey | AAJMYBUSIIZIAY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|