C13H9N3O3S — CID 39198113
6-(2,3-dihydro-1,4-benzodioxin-6-yl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde (PubChem CID 39198113) has the molecular formula C13H9N3O3S and a molecular weight of 287.30 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-yl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198113 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
| SMILES | O=Cc1c(-c2ccc3c(c2)OCCO3)nc2scnn12 |
| InChI | InChI=1S/C13H9N3O3S/c17-6-9-12(15-13-16(9)14-7-20-13)8-1-2-10-11(5-8)19-4-3-18-10/h1-2,5-7H,3-4H2 |
| InChIKey | OIHLBWPWRUOCFH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|