C11H11N5 — CID 39220123
3-(5-methyl-1H-pyrazol-4-yl)-1H-indazol-5-amine (PubChem CID 39220123) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-(5-methyl-1H-pyrazol-4-yl)-1H-indazol-5-amine.
| Compound Name | 3-(5-methyl-1H-pyrazol-4-yl)-1H-indazol-5-amine |
|---|---|
| PubChem CID | 39220123 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-(5-methyl-1H-pyrazol-4-yl)-1H-indazol-5-amine |
| SMILES | Cc1[nH]ncc1-c1n[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C11H11N5/c1-6-9(5-13-14-6)11-8-4-7(12)2-3-10(8)15-16-11/h2-5H,12H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | OGBQCMDQQYPYPC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|