C15H18N2O4 — CID 39234664
2-[4-(dimethylamino)-6,8-dimethoxyquinolin-1-ium-2-yl]acetate (PubChem CID 39234664) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-6,8-dimethoxyquinolin-1-ium-2-yl]acetate.
| Compound Name | 2-[4-(dimethylamino)-6,8-dimethoxyquinolin-1-ium-2-yl]acetate |
|---|---|
| PubChem CID | 39234664 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[4-(dimethylamino)-6,8-dimethoxyquinolin-1-ium-2-yl]acetate |
| SMILES | COc1cc(OC)c2[nH+]c(CC(=O)[O-])cc(N(C)C)c2c1 |
| InChI | InChI=1S/C15H18N2O4/c1-17(2)12-5-9(6-14(18)19)16-15-11(12)7-10(20-3)8-13(15)21-4/h5,7-8H,6H2,1-4H3,(H,18,19) |
| InChIKey | BBBRPFOVYLFUNS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 75.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |