C26H24N4O4S — CID 39260069
4-[(2-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-methylpyrimidin-4-yl)phenyl]benzamide (PubChem CID 39260069) has the molecular formula C26H24N4O4S and a molecular weight of 488.57 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-methylpyrimidin-4-yl)phenyl]benzamide.
| Compound Name | 4-[(2-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-methylpyrimidin-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 39260069 |
| Molecular Formula | C26H24N4O4S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 4-[(2-methoxyphenyl)-methylsulfamoyl]-N-[3-(2-methylpyrimidin-4-yl)phenyl]benzamide |
| SMILES | COc1ccccc1N(C)S(=O)(=O)c1ccc(C(=O)Nc2cccc(-c3ccnc(C)n3)c2)cc1 |
| InChI | InChI=1S/C26H24N4O4S/c1-18-27-16-15-23(28-18)20-7-6-8-21(17-20)29-26(31)19-11-13-22(14-12-19)35(32,33)30(2)24-9-4-5-10-25(24)34-3/h4-17H,1-3H3,(H,29,31) |
| InChIKey | GVGXTVRVYQXJGX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |