C22H23N5O6S — CID 3927592
N'-(3-morpholin-4-ylsulfonylbenzoyl)-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbohydrazide (PubChem CID 3927592) has the molecular formula C22H23N5O6S and a molecular weight of 485.52 g/mol. Its IUPAC name is N'-(3-morpholin-4-ylsulfonylbenzoyl)-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbohydrazide.
| Compound Name | N'-(3-morpholin-4-ylsulfonylbenzoyl)-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 3927592 |
| Molecular Formula | C22H23N5O6S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N'-(3-morpholin-4-ylsulfonylbenzoyl)-6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)C1=NN(c2ccccc2)C(=O)CC1 |
| InChI | InChI=1S/C22H23N5O6S/c28-20-10-9-19(25-27(20)17-6-2-1-3-7-17)22(30)24-23-21(29)16-5-4-8-18(15-16)34(31,32)26-11-13-33-14-12-26/h1-8,15H,9-14H2,(H,23,29)(H,24,30) |
| InChIKey | JQXNBZUBYVGWAE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 137.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|