C17H11N3O3S2 — CID 39299357
N-benzo[e][1,3]benzothiazol-2-yl-5-methyl-4-nitrothiophene-2-carboxamide (PubChem CID 39299357) has the molecular formula C17H11N3O3S2 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-benzo[e][1,3]benzothiazol-2-yl-5-methyl-4-nitrothiophene-2-carboxamide.
| Compound Name | N-benzo[e][1,3]benzothiazol-2-yl-5-methyl-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 39299357 |
| Molecular Formula | C17H11N3O3S2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N-benzo[e][1,3]benzothiazol-2-yl-5-methyl-4-nitrothiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)Nc2nc3c(ccc4ccccc43)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11N3O3S2/c1-9-12(20(22)23)8-14(24-9)16(21)19-17-18-15-11-5-3-2-4-10(11)6-7-13(15)25-17/h2-8H,1H3,(H,18,19,21) |
| InChIKey | DJUZAHRRRHXRDH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|