C23H23N3O4S — CID 39311053
(2S)-5,6-dimethoxy-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-2,3-dihydroinden-1-one (PubChem CID 39311053) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is (2S)-5,6-dimethoxy-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-2,3-dihydroinden-1-one.
| Compound Name | (2S)-5,6-dimethoxy-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 39311053 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (2S)-5,6-dimethoxy-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-2,3-dihydroinden-1-one |
| SMILES | C=CCn1c(S[C@H]2Cc3cc(OC)c(OC)cc3C2=O)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-5-10-26-22(14-6-8-16(28-2)9-7-14)24-25-23(26)31-20-12-15-11-18(29-3)19(30-4)13-17(15)21(20)27/h5-9,11,13,20H,1,10,12H2,2-4H3/t20-/m0/s1 |
| InChIKey | QAISVHPHONNPOQ-FQEVSTJZSA-N |
| XLogP | 4.06 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|