C18H21N3O2S — CID 7813896
(2R)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]cyclohexan-1-one (PubChem CID 7813896) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is (2R)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]cyclohexan-1-one.
| Compound Name | (2R)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 7813896 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2R)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]cyclohexan-1-one |
| SMILES | C=CCn1c(S[C@@H]2CCCCC2=O)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-3-12-21-17(13-8-10-14(23-2)11-9-13)19-20-18(21)24-16-7-5-4-6-15(16)22/h3,8-11,16H,1,4-7,12H2,2H3/t16-/m1/s1 |
| InChIKey | QLVSIGKTOVOXTP-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|