C21H27N3OS — CID 7814504
(2R)-2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]cyclohexan-1-one (PubChem CID 7814504) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is (2R)-2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]cyclohexan-1-one.
| Compound Name | (2R)-2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 7814504 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2R)-2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]cyclohexan-1-one |
| SMILES | C=CCn1c(S[C@@H]2CCCCC2=O)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H27N3OS/c1-5-14-24-19(15-10-12-16(13-11-15)21(2,3)4)22-23-20(24)26-18-9-7-6-8-17(18)25/h5,10-13,18H,1,6-9,14H2,2-4H3/t18-/m1/s1 |
| InChIKey | VQVGBJAYENIWMU-GOSISDBHSA-N |
| XLogP | 5.03 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|