C17H18N4O2S2 — CID 39340955
3-[[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 39340955) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-[[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 39340955 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-[[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=C(C)CSc1nnc(Cn2cnc3sc4c(c3c2=O)CCCC4)o1 |
| InChI | InChI=1S/C17H18N4O2S2/c1-10(2)8-24-17-20-19-13(23-17)7-21-9-18-15-14(16(21)22)11-5-3-4-6-12(11)25-15/h9H,1,3-8H2,2H3 |
| InChIKey | JZTACNQSGWTCIS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|