C21H16ClN5OS — CID 39343143
8-[(2-chlorophenyl)methyl]-11,12-dimethyl-4-pyridin-3-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one (PubChem CID 39343143) has the molecular formula C21H16ClN5OS and a molecular weight of 421.91 g/mol. Its IUPAC name is 8-[(2-chlorophenyl)methyl]-11,12-dimethyl-4-pyridin-3-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one.
| Compound Name | 8-[(2-chlorophenyl)methyl]-11,12-dimethyl-4-pyridin-3-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
|---|---|
| PubChem CID | 39343143 |
| Molecular Formula | C21H16ClN5OS |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 8-[(2-chlorophenyl)methyl]-11,12-dimethyl-4-pyridin-3-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
| SMILES | Cc1sc2c(c1C)c1nc(-c3cccnc3)nn1c(=O)n2Cc1ccccc1Cl |
| InChI | InChI=1S/C21H16ClN5OS/c1-12-13(2)29-20-17(12)19-24-18(14-7-5-9-23-10-14)25-27(19)21(28)26(20)11-15-6-3-4-8-16(15)22/h3-10H,11H2,1-2H3 |
| InChIKey | OIFIDCKHLMKKCJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |