C19H14FN3OS — CID 39349699
2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(1H-indol-6-yl)acetamide (PubChem CID 39349699) has the molecular formula C19H14FN3OS and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(1H-indol-6-yl)acetamide.
| Compound Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(1H-indol-6-yl)acetamide |
|---|---|
| PubChem CID | 39349699 |
| Molecular Formula | C19H14FN3OS |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(1H-indol-6-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2ccc(F)cc2)n1)Nc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C19H14FN3OS/c20-14-4-1-13(2-5-14)19-23-16(11-25-19)10-18(24)22-15-6-3-12-7-8-21-17(12)9-15/h1-9,11,21H,10H2,(H,22,24) |
| InChIKey | MCTDBTDZQQWTJI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |