C14H16N2O3 — CID 39360616
N'-(1,3-benzodioxol-5-yl)-N'-(furan-2-ylmethyl)ethane-1,2-diamine (PubChem CID 39360616) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N'-(furan-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N'-(furan-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 39360616 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N'-(furan-2-ylmethyl)ethane-1,2-diamine |
| SMILES | NCCN(Cc1ccco1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H16N2O3/c15-5-6-16(9-12-2-1-7-17-12)11-3-4-13-14(8-11)19-10-18-13/h1-4,7-8H,5-6,9-10,15H2 |
| InChIKey | LXZYKYMJZSMGRO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|