C12H13N5OS — CID 39374269
3-[(2,5-dimethylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine (PubChem CID 39374269) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine.
| Compound Name | 3-[(2,5-dimethylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine |
|---|---|
| PubChem CID | 39374269 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-[(2,5-dimethylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine |
| SMILES | Cc1ccc(C)c(OCc2nnc3sc(N)nn23)c1 |
| InChI | InChI=1S/C12H13N5OS/c1-7-3-4-8(2)9(5-7)18-6-10-14-15-12-17(10)16-11(13)19-12/h3-5H,6H2,1-2H3,(H2,13,16) |
| InChIKey | YRNQGUJBUIAWJV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |