C17H23N3O — CID 136559841
3-[(2,5-dimethylphenoxy)methyl]-6,6-dimethyl-7,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 136559841) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenoxy)methyl]-6,6-dimethyl-7,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[(2,5-dimethylphenoxy)methyl]-6,6-dimethyl-7,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 136559841 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 3-[(2,5-dimethylphenoxy)methyl]-6,6-dimethyl-7,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1ccc(C)c(OCc2nnc3n2CC(C)(C)CC3)c1 |
| InChI | InChI=1S/C17H23N3O/c1-12-5-6-13(2)14(9-12)21-10-16-19-18-15-7-8-17(3,4)11-20(15)16/h5-6,9H,7-8,10-11H2,1-4H3 |
| InChIKey | VTCIAPFDTFXNKI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |