C28H28FN3O4 — CID 3937677
3-fluoro-N-[[3-methoxy-4-[[4-(piperidine-1-carbonyl)phenyl]methoxy]phenyl]methylideneamino]benzamide (PubChem CID 3937677) has the molecular formula C28H28FN3O4 and a molecular weight of 489.55 g/mol. Its IUPAC name is 3-fluoro-N-[[3-methoxy-4-[[4-(piperidine-1-carbonyl)phenyl]methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 3-fluoro-N-[[3-methoxy-4-[[4-(piperidine-1-carbonyl)phenyl]methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3937677 |
| Molecular Formula | C28H28FN3O4 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 3-fluoro-N-[[3-methoxy-4-[[4-(piperidine-1-carbonyl)phenyl]methoxy]phenyl]methylideneamino]benzamide |
| SMILES | COc1cc(C=NNC(=O)c2cccc(F)c2)ccc1OCc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H28FN3O4/c1-35-26-16-21(18-30-31-27(33)23-6-5-7-24(29)17-23)10-13-25(26)36-19-20-8-11-22(12-9-20)28(34)32-14-3-2-4-15-32/h5-13,16-18H,2-4,14-15,19H2,1H3,(H,31,33) |
| InChIKey | BZAYSOURWYYOTH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|