C22H26BrNO3 — CID 3943198
1-[(5-bromo-2-ethoxyphenyl)-(4-methylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 3943198) has the molecular formula C22H26BrNO3 and a molecular weight of 432.36 g/mol. Its IUPAC name is 1-[(5-bromo-2-ethoxyphenyl)-(4-methylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(5-bromo-2-ethoxyphenyl)-(4-methylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3943198 |
| Molecular Formula | C22H26BrNO3 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 1-[(5-bromo-2-ethoxyphenyl)-(4-methylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | CCOc1ccc(Br)cc1C(c1ccc(C)cc1)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C22H26BrNO3/c1-3-27-20-12-11-17(23)14-18(20)21(16-9-7-15(2)8-10-16)24-13-5-4-6-19(24)22(25)26/h7-12,14,19,21H,3-6,13H2,1-2H3,(H,25,26) |
| InChIKey | STJCXKYKWZTGNW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |