C24H30N4O4 — CID 39440498
(E)-N-[3-[4-[2-(2,3-dimethylanilino)-2-oxoethyl]piperazin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 39440498) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is (E)-N-[3-[4-[2-(2,3-dimethylanilino)-2-oxoethyl]piperazin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-[4-[2-(2,3-dimethylanilino)-2-oxoethyl]piperazin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 39440498 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (E)-N-[3-[4-[2-(2,3-dimethylanilino)-2-oxoethyl]piperazin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)CN2CCN(C(=O)CCNC(=O)/C=C/c3ccco3)CC2)c1C |
| InChI | InChI=1S/C24H30N4O4/c1-18-5-3-7-21(19(18)2)26-23(30)17-27-12-14-28(15-13-27)24(31)10-11-25-22(29)9-8-20-6-4-16-32-20/h3-9,16H,10-15,17H2,1-2H3,(H,25,29)(H,26,30)/b9-8+ |
| InChIKey | UJUHKVYOBISHNT-CMDGGOBGSA-N |
| XLogP | 2.20 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|