C27H27F2N3O3 — CID 39471393
(E)-N-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 39471393) has the molecular formula C27H27F2N3O3 and a molecular weight of 479.53 g/mol. Its IUPAC name is (E)-N-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 39471393 |
| Molecular Formula | C27H27F2N3O3 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (E)-N-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-3-oxopropyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NCCC(=O)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H27F2N3O3/c28-22-7-3-20(4-8-22)27(21-5-9-23(29)10-6-21)32-17-15-31(16-18-32)26(34)13-14-30-25(33)12-11-24-2-1-19-35-24/h1-12,19,27H,13-18H2,(H,30,33)/b12-11+ |
| InChIKey | WLZYYSYUJVMHHT-VAWYXSNFSA-N |
| XLogP | 4.01 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|