C24H23F2N3O3 — CID 46429322
N-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]furan-3-carboxamide (PubChem CID 46429322) has the molecular formula C24H23F2N3O3 and a molecular weight of 439.46 g/mol. Its IUPAC name is N-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]furan-3-carboxamide.
| Compound Name | N-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 46429322 |
| Molecular Formula | C24H23F2N3O3 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]furan-3-carboxamide |
| SMILES | O=C(NCC(=O)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1)c1ccoc1 |
| InChI | InChI=1S/C24H23F2N3O3/c25-20-5-1-17(2-6-20)23(18-3-7-21(26)8-4-18)29-12-10-28(11-13-29)22(30)15-27-24(31)19-9-14-32-16-19/h1-9,14,16,23H,10-13,15H2,(H,27,31) |
| InChIKey | STYJJNFYDVAFNK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |