C17H22N4O5 — CID 55816213
N-[2-oxo-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]ethyl]furan-3-carboxamide (PubChem CID 55816213) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[2-oxo-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]ethyl]furan-3-carboxamide.
| Compound Name | N-[2-oxo-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 55816213 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[2-oxo-2-[4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazin-1-yl]ethyl]furan-3-carboxamide |
| SMILES | O=C(NCC(=O)N1CCN(C(=O)C(=O)N2CCCC2)CC1)c1ccoc1 |
| InChI | InChI=1S/C17H22N4O5/c22-14(11-18-15(23)13-3-10-26-12-13)19-6-8-21(9-7-19)17(25)16(24)20-4-1-2-5-20/h3,10,12H,1-2,4-9,11H2,(H,18,23) |
| InChIKey | DDNVZAXITKTBOH-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|