C24H27FN2O5 — CID 91641497
3-(4-fluorophenyl)-3-[1-[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoyl]piperidin-4-yl]propanoic acid (PubChem CID 91641497) has the molecular formula C24H27FN2O5 and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-[1-[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-(4-fluorophenyl)-3-[1-[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 91641497 |
| Molecular Formula | C24H27FN2O5 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-(4-fluorophenyl)-3-[1-[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoyl]piperidin-4-yl]propanoic acid |
| SMILES | O=C(O)CC(c1ccc(F)cc1)C1CCN(C(=O)CCNC(=O)/C=C/c2ccco2)CC1 |
| InChI | InChI=1S/C24H27FN2O5/c25-19-5-3-17(4-6-19)21(16-24(30)31)18-10-13-27(14-11-18)23(29)9-12-26-22(28)8-7-20-2-1-15-32-20/h1-8,15,18,21H,9-14,16H2,(H,26,28)(H,30,31)/b8-7+ |
| InChIKey | JADQBERBBKTCFD-BQYQJAHWSA-N |
| XLogP | 3.44 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|