C19H17NO3 — CID 3945141
N-[2,7-bis(prop-2-enoxy)fluoren-9-ylidene]hydroxylamine (PubChem CID 3945141) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-[2,7-bis(prop-2-enoxy)fluoren-9-ylidene]hydroxylamine.
| Compound Name | N-[2,7-bis(prop-2-enoxy)fluoren-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 3945141 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-[2,7-bis(prop-2-enoxy)fluoren-9-ylidene]hydroxylamine |
| SMILES | C=CCOc1ccc2c(c1)C(=NO)c1cc(OCC=C)ccc1-2 |
| InChI | InChI=1S/C19H17NO3/c1-3-9-22-13-5-7-15-16-8-6-14(23-10-4-2)12-18(16)19(20-21)17(15)11-13/h3-8,11-12,21H,1-2,9-10H2 |
| InChIKey | ZHWDTAIBCPAVJB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|