C19H15N3O2 — CID 3949677
2-(6-methyl-1H-benzimidazol-2-yl)-3-(6-methyl-1,3-benzodioxol-5-yl)prop-2-enenitrile (PubChem CID 3949677) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-(6-methyl-1H-benzimidazol-2-yl)-3-(6-methyl-1,3-benzodioxol-5-yl)prop-2-enenitrile.
| Compound Name | 2-(6-methyl-1H-benzimidazol-2-yl)-3-(6-methyl-1,3-benzodioxol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3949677 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-(6-methyl-1H-benzimidazol-2-yl)-3-(6-methyl-1,3-benzodioxol-5-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3cc4c(cc3C)OCO4)[nH]c2c1 |
| InChI | InChI=1S/C19H15N3O2/c1-11-3-4-15-16(5-11)22-19(21-15)14(9-20)7-13-8-18-17(6-12(13)2)23-10-24-18/h3-8H,10H2,1-2H3,(H,21,22) |
| InChIKey | REBABABLFDNARI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|