C19H21Cl2N3O3 — CID 39521017
4-chloro-N-[(2S)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-nitrobenzamide (PubChem CID 39521017) has the molecular formula C19H21Cl2N3O3 and a molecular weight of 410.30 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-nitrobenzamide.
| Compound Name | 4-chloro-N-[(2S)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 39521017 |
| Molecular Formula | C19H21Cl2N3O3 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 4-chloro-N-[(2S)-2-(2-chlorophenyl)-2-(diethylamino)ethyl]-2-nitrobenzamide |
| SMILES | CCN(CC)[C@H](CNC(=O)c1ccc(Cl)cc1[N+](=O)[O-])c1ccccc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O3/c1-3-23(4-2)18(14-7-5-6-8-16(14)21)12-22-19(25)15-10-9-13(20)11-17(15)24(26)27/h5-11,18H,3-4,12H2,1-2H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | WKDMMPHZJQRSCW-GOSISDBHSA-N |
| XLogP | 4.71 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|