C22H26ClN5O3 — CID 39540327
(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]prop-2-enamide (PubChem CID 39540327) has the molecular formula C22H26ClN5O3 and a molecular weight of 443.94 g/mol. Its IUPAC name is (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 39540327 |
| Molecular Formula | C22H26ClN5O3 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCCO2)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H26ClN5O3/c23-18-15-17(16-19-21(18)31-14-13-30-19)3-4-20(29)24-7-2-8-27-9-11-28(12-10-27)22-25-5-1-6-26-22/h1,3-6,15-16H,2,7-14H2,(H,24,29)/b4-3+ |
| InChIKey | WPUBIIAMDYPLGC-ONEGZZNKSA-N |
| XLogP | 2.24 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|