C19H18BrN2O4S- — CID 3955292
3-[3-amino-1-(4-bromophenyl)-2-cyano-3-sulfanylidenepropyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate (PubChem CID 3955292) has the molecular formula C19H18BrN2O4S- and a molecular weight of 450.33 g/mol. Its IUPAC name is 3-[3-amino-1-(4-bromophenyl)-2-cyano-3-sulfanylidenepropyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate.
| Compound Name | 3-[3-amino-1-(4-bromophenyl)-2-cyano-3-sulfanylidenepropyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
|---|---|
| PubChem CID | 3955292 |
| Molecular Formula | C19H18BrN2O4S- |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 3-[3-amino-1-(4-bromophenyl)-2-cyano-3-sulfanylidenepropyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
| SMILES | N#CC(C(N)=S)C(C1=C([O-])OC2(CCCCC2)OC1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H19BrN2O4S/c20-12-6-4-11(5-7-12)14(13(10-21)16(22)27)15-17(23)25-19(26-18(15)24)8-2-1-3-9-19/h4-7,13-14,23H,1-3,8-9H2,(H2,22,27)/p-1 |
| InChIKey | NOCCOIPGFXQSPA-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|