C21H24N2O6S — CID 3324592
2-cyano-3-(3,4-dimethoxyphenyl)-3-(2-hydroxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)propanethioamide (PubChem CID 3324592) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-cyano-3-(3,4-dimethoxyphenyl)-3-(2-hydroxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)propanethioamide.
| Compound Name | 2-cyano-3-(3,4-dimethoxyphenyl)-3-(2-hydroxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)propanethioamide |
|---|---|
| PubChem CID | 3324592 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-cyano-3-(3,4-dimethoxyphenyl)-3-(2-hydroxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)propanethioamide |
| SMILES | COc1ccc(C(C2=C(O)OC3(CCCCC3)OC2=O)C(C#N)C(N)=S)cc1OC |
| InChI | InChI=1S/C21H24N2O6S/c1-26-14-7-6-12(10-15(14)27-2)16(13(11-22)18(23)30)17-19(24)28-21(29-20(17)25)8-4-3-5-9-21/h6-7,10,13,16,24H,3-5,8-9H2,1-2H3,(H2,23,30) |
| InChIKey | BIXHIFPCNCPTHS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|