C12H15Cl3N2O — CID 3955467
2-piperazin-1-yl-1-(2,3,4-trichlorophenyl)ethanol (PubChem CID 3955467) has the molecular formula C12H15Cl3N2O and a molecular weight of 309.62 g/mol. Its IUPAC name is 2-piperazin-1-yl-1-(2,3,4-trichlorophenyl)ethanol.
| Compound Name | 2-piperazin-1-yl-1-(2,3,4-trichlorophenyl)ethanol |
|---|---|
| PubChem CID | 3955467 |
| Molecular Formula | C12H15Cl3N2O |
| Molecular Weight | 309.62 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2-piperazin-1-yl-1-(2,3,4-trichlorophenyl)ethanol |
| SMILES | OC(CN1CCNCC1)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H15Cl3N2O/c13-9-2-1-8(11(14)12(9)15)10(18)7-17-5-3-16-4-6-17/h1-2,10,16,18H,3-7H2 |
| InChIKey | XBENHYACVIFNJH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|