C23H30ClN3O2S — CID 39567477
N-[6-[4-[[5-(2-chlorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-6-oxohexyl]acetamide (PubChem CID 39567477) has the molecular formula C23H30ClN3O2S and a molecular weight of 448.03 g/mol. Its IUPAC name is N-[6-[4-[[5-(2-chlorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-6-oxohexyl]acetamide.
| Compound Name | N-[6-[4-[[5-(2-chlorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-6-oxohexyl]acetamide |
|---|---|
| PubChem CID | 39567477 |
| Molecular Formula | C23H30ClN3O2S |
| Molecular Weight | 448.03 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-[6-[4-[[5-(2-chlorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-6-oxohexyl]acetamide |
| SMILES | CC(=O)NCCCCCC(=O)N1CCN(Cc2ccc(-c3ccccc3Cl)s2)CC1 |
| InChI | InChI=1S/C23H30ClN3O2S/c1-18(28)25-12-6-2-3-9-23(29)27-15-13-26(14-16-27)17-19-10-11-22(30-19)20-7-4-5-8-21(20)24/h4-5,7-8,10-11H,2-3,6,9,12-17H2,1H3,(H,25,28) |
| InChIKey | MEPAMHCIWOMWJX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.03 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|