C21H25N3O6 — CID 3957591
2-[4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetamide (PubChem CID 3957591) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-[4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 3957591 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-[4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(C=C2C(=O)NC(=O)N(C3CCCCC3)C2=O)ccc1OCC(N)=O |
| InChI | InChI=1S/C21H25N3O6/c1-2-29-17-11-13(8-9-16(17)30-12-18(22)25)10-15-19(26)23-21(28)24(20(15)27)14-6-4-3-5-7-14/h8-11,14H,2-7,12H2,1H3,(H2,22,25)(H,23,26,28) |
| InChIKey | RGCRMJPGMICZTD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|