C20H21IN2O6 — CID 4045918
methyl 2-[4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-iodophenoxy]acetate (PubChem CID 4045918) has the molecular formula C20H21IN2O6 and a molecular weight of 512.30 g/mol. Its IUPAC name is methyl 2-[4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-iodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-iodophenoxy]acetate |
|---|---|
| PubChem CID | 4045918 |
| Molecular Formula | C20H21IN2O6 |
| Molecular Weight | 512.30 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | methyl 2-[4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-iodophenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C=C2C(=O)NC(=O)N(C3CCCCC3)C2=O)cc1I |
| InChI | InChI=1S/C20H21IN2O6/c1-28-17(24)11-29-16-8-7-12(10-15(16)21)9-14-18(25)22-20(27)23(19(14)26)13-5-3-2-4-6-13/h7-10,13H,2-6,11H2,1H3,(H,22,25,27) |
| InChIKey | PQWNSYWATZVESP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|