C21H23BrN2O7 — CID 3371028
2-[5-bromo-4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetic acid (PubChem CID 3371028) has the molecular formula C21H23BrN2O7 and a molecular weight of 495.33 g/mol. Its IUPAC name is 2-[5-bromo-4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[5-bromo-4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 3371028 |
| Molecular Formula | C21H23BrN2O7 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 2-[5-bromo-4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(C=C2C(=O)NC(=O)N(C3CCCCC3)C2=O)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C21H23BrN2O7/c1-2-30-16-9-12(15(22)10-17(16)31-11-18(25)26)8-14-19(27)23-21(29)24(20(14)28)13-6-4-3-5-7-13/h8-10,13H,2-7,11H2,1H3,(H,25,26)(H,23,27,29) |
| InChIKey | LARYVFSIUVIULU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|