C25H32ClNO5 — CID 39587016
(E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]prop-2-enamide (PubChem CID 39587016) has the molecular formula C25H32ClNO5 and a molecular weight of 461.99 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 39587016 |
| Molecular Formula | C25H32ClNO5 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CCOCCOCc1cccc(CNC(=O)/C=C/c2cc(Cl)c(OC(C)C)c(OC)c2)c1 |
| InChI | InChI=1S/C25H32ClNO5/c1-5-30-11-12-31-17-21-8-6-7-20(13-21)16-27-24(28)10-9-19-14-22(26)25(32-18(2)3)23(15-19)29-4/h6-10,13-15,18H,5,11-12,16-17H2,1-4H3,(H,27,28)/b10-9+ |
| InChIKey | LRIPGTHHQWTHNA-MDZDMXLPSA-N |
| XLogP | 5.02 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|