C13H18NO3+ — CID 3959855
(1-methylpiperidin-1-ium-3-yl) 3-(furan-2-yl)prop-2-enoate (PubChem CID 3959855) has the molecular formula C13H18NO3+ and a molecular weight of 236.29 g/mol. Its IUPAC name is (1-methylpiperidin-1-ium-3-yl) 3-(furan-2-yl)prop-2-enoate.
| Compound Name | (1-methylpiperidin-1-ium-3-yl) 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3959855 |
| Molecular Formula | C13H18NO3+ |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (1-methylpiperidin-1-ium-3-yl) 3-(furan-2-yl)prop-2-enoate |
| SMILES | C[NH+]1CCCC(OC(=O)C=Cc2ccco2)C1 |
| InChI | InChI=1S/C13H17NO3/c1-14-8-2-4-12(10-14)17-13(15)7-6-11-5-3-9-16-11/h3,5-7,9,12H,2,4,8,10H2,1H3/p+1 |
| InChIKey | WULPVMDCYDKLDW-UHFFFAOYSA-O |
| XLogP | 0.51 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|