C15H16N2O4S — CID 39613699
N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-5-nitrofuran-2-carboxamide (PubChem CID 39613699) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 39613699 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-5-nitrofuran-2-carboxamide |
| SMILES | O=C(N[C@H](c1cccs1)C1CCCC1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C15H16N2O4S/c18-15(11-7-8-13(21-11)17(19)20)16-14(10-4-1-2-5-10)12-6-3-9-22-12/h3,6-10,14H,1-2,4-5H2,(H,16,18)/t14-/m0/s1 |
| InChIKey | JACSXKHWBOJIEI-AWEZNQCLSA-N |
| XLogP | 3.91 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|