C12H12FNO5S — CID 3963659
(1,1-dioxothiolan-3-yl) N-(3-fluorobenzoyl)carbamate (PubChem CID 3963659) has the molecular formula C12H12FNO5S and a molecular weight of 301.29 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) N-(3-fluorobenzoyl)carbamate.
| Compound Name | (1,1-dioxothiolan-3-yl) N-(3-fluorobenzoyl)carbamate |
|---|---|
| PubChem CID | 3963659 |
| Molecular Formula | C12H12FNO5S |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) N-(3-fluorobenzoyl)carbamate |
| SMILES | O=C(NC(=O)c1cccc(F)c1)OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12FNO5S/c13-9-3-1-2-8(6-9)11(15)14-12(16)19-10-4-5-20(17,18)7-10/h1-3,6,10H,4-5,7H2,(H,14,15,16) |
| InChIKey | XQTAJEKVRWYHMX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |