C24H20N4O2 — CID 39678341
N-[3-[[2-(4-pyrrol-1-ylphenyl)acetyl]amino]phenyl]pyridine-4-carboxamide (PubChem CID 39678341) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[3-[[2-(4-pyrrol-1-ylphenyl)acetyl]amino]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[2-(4-pyrrol-1-ylphenyl)acetyl]amino]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 39678341 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[3-[[2-(4-pyrrol-1-ylphenyl)acetyl]amino]phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Cc1ccc(-n2cccc2)cc1)Nc1cccc(NC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C24H20N4O2/c29-23(16-18-6-8-22(9-7-18)28-14-1-2-15-28)26-20-4-3-5-21(17-20)27-24(30)19-10-12-25-13-11-19/h1-15,17H,16H2,(H,26,29)(H,27,30) |
| InChIKey | GGFWLMHTORRBIU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |