C32H36Cl2N4OS — CID 3968057
N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3,5,5-trimethylhexanamide (PubChem CID 3968057) has the molecular formula C32H36Cl2N4OS and a molecular weight of 595.64 g/mol. Its IUPAC name is N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3,5,5-trimethylhexanamide.
| Compound Name | N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 3968057 |
| Molecular Formula | C32H36Cl2N4OS |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NC(Cc1ccccc1)c1nnc(SCc2ccccc2)n1-c1ccc(Cl)cc1Cl)CC(C)(C)C |
| InChI | InChI=1S/C32H36Cl2N4OS/c1-22(20-32(2,3)4)17-29(39)35-27(18-23-11-7-5-8-12-23)30-36-37-31(40-21-24-13-9-6-10-14-24)38(30)28-16-15-25(33)19-26(28)34/h5-16,19,22,27H,17-18,20-21H2,1-4H3,(H,35,39) |
| InChIKey | VFVSUFUEMQWYIL-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |