C25H20Cl4N4OS — CID 42748700
N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,2-dichloroacetamide (PubChem CID 42748700) has the molecular formula C25H20Cl4N4OS and a molecular weight of 566.34 g/mol. Its IUPAC name is N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,2-dichloroacetamide.
| Compound Name | N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 42748700 |
| Molecular Formula | C25H20Cl4N4OS |
| Molecular Weight | 566.34 g/mol |
| Exact Mass | 564.01 |
| IUPAC Name | N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]-2-phenylethyl]-2,2-dichloroacetamide |
| SMILES | O=C(NC(Cc1ccccc1)c1nnc(SCc2ccccc2)n1-c1ccc(Cl)cc1Cl)C(Cl)Cl |
| InChI | InChI=1S/C25H20Cl4N4OS/c26-18-11-12-21(19(27)14-18)33-23(31-32-25(33)35-15-17-9-5-2-6-10-17)20(30-24(34)22(28)29)13-16-7-3-1-4-8-16/h1-12,14,20,22H,13,15H2,(H,30,34) |
| InChIKey | FJHLXMLYCCXXJJ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.34 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|