C32H35Cl2FN4OS — CID 3302431
N-[1-[4-(2,4-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]nonanamide (PubChem CID 3302431) has the molecular formula C32H35Cl2FN4OS and a molecular weight of 613.63 g/mol. Its IUPAC name is N-[1-[4-(2,4-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]nonanamide.
| Compound Name | N-[1-[4-(2,4-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]nonanamide |
|---|---|
| PubChem CID | 3302431 |
| Molecular Formula | C32H35Cl2FN4OS |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | N-[1-[4-(2,4-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NC(Cc1ccccc1)c1nnc(SCc2ccc(F)cc2)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H35Cl2FN4OS/c1-2-3-4-5-6-10-13-30(40)36-28(20-23-11-8-7-9-12-23)31-37-38-32(41-22-24-14-17-26(35)18-15-24)39(31)29-19-16-25(33)21-27(29)34/h7-9,11-12,14-19,21,28H,2-6,10,13,20,22H2,1H3,(H,36,40) |
| InChIKey | NTMQQUPSOXCIDD-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|