C25H30Cl2N4OS — CID 42745950
N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]octanamide (PubChem CID 42745950) has the molecular formula C25H30Cl2N4OS and a molecular weight of 505.52 g/mol. Its IUPAC name is N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]octanamide.
| Compound Name | N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]octanamide |
|---|---|
| PubChem CID | 42745950 |
| Molecular Formula | C25H30Cl2N4OS |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]octanamide |
| SMILES | CCCCCCCC(=O)NC(C)c1nnc(SCc2ccccc2)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H30Cl2N4OS/c1-3-4-5-6-10-13-23(32)28-18(2)24-29-30-25(33-17-19-11-8-7-9-12-19)31(24)22-15-14-20(26)16-21(22)27/h7-9,11-12,14-16,18H,3-6,10,13,17H2,1-2H3,(H,28,32) |
| InChIKey | QATAJPPCEMSGEG-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|