C32H36ClFN4OS — CID 42746748
N-[1-[4-(5-chloro-2-methylphenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octanamide (PubChem CID 42746748) has the molecular formula C32H36ClFN4OS and a molecular weight of 579.19 g/mol. Its IUPAC name is N-[1-[4-(5-chloro-2-methylphenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octanamide.
| Compound Name | N-[1-[4-(5-chloro-2-methylphenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octanamide |
|---|---|
| PubChem CID | 42746748 |
| Molecular Formula | C32H36ClFN4OS |
| Molecular Weight | 579.19 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | N-[1-[4-(5-chloro-2-methylphenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octanamide |
| SMILES | CCCCCCCC(=O)NC(Cc1ccccc1)c1nnc(SCc2ccc(F)cc2)n1-c1cc(Cl)ccc1C |
| InChI | InChI=1S/C32H36ClFN4OS/c1-3-4-5-6-10-13-30(39)35-28(20-24-11-8-7-9-12-24)31-36-37-32(40-22-25-15-18-27(34)19-16-25)38(31)29-21-26(33)17-14-23(29)2/h7-9,11-12,14-19,21,28H,3-6,10,13,20,22H2,1-2H3,(H,35,39) |
| InChIKey | RHFIALGRMZAXFN-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.19 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|