C33H39ClN4OS — CID 4988846
N-[1-[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octanamide (PubChem CID 4988846) has the molecular formula C33H39ClN4OS and a molecular weight of 575.22 g/mol. Its IUPAC name is N-[1-[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octanamide.
| Compound Name | N-[1-[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octanamide |
|---|---|
| PubChem CID | 4988846 |
| Molecular Formula | C33H39ClN4OS |
| Molecular Weight | 575.22 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | N-[1-[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octanamide |
| SMILES | CCCCCCCC(=O)NC(Cc1ccccc1)c1nnc(SCc2cccc(C)c2)n1-c1cc(Cl)ccc1C |
| InChI | InChI=1S/C33H39ClN4OS/c1-4-5-6-7-11-17-31(39)35-29(21-26-14-9-8-10-15-26)32-36-37-33(40-23-27-16-12-13-24(2)20-27)38(32)30-22-28(34)19-18-25(30)3/h8-10,12-16,18-20,22,29H,4-7,11,17,21,23H2,1-3H3,(H,35,39) |
| InChIKey | MITLEJOKDIHOGP-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.22 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|