C32H38Cl2N4O2S2 — CID 4570571
N-[1-[4-(2,4-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octane-1-sulfonamide (PubChem CID 4570571) has the molecular formula C32H38Cl2N4O2S2 and a molecular weight of 645.72 g/mol. Its IUPAC name is N-[1-[4-(2,4-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octane-1-sulfonamide.
| Compound Name | N-[1-[4-(2,4-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octane-1-sulfonamide |
|---|---|
| PubChem CID | 4570571 |
| Molecular Formula | C32H38Cl2N4O2S2 |
| Molecular Weight | 645.72 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | N-[1-[4-(2,4-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylethyl]octane-1-sulfonamide |
| SMILES | CCCCCCCCS(=O)(=O)NC(Cc1ccccc1)c1nnc(SCc2cccc(C)c2)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H38Cl2N4O2S2/c1-3-4-5-6-7-11-19-42(39,40)37-29(21-25-14-9-8-10-15-25)31-35-36-32(41-23-26-16-12-13-24(2)20-26)38(31)30-18-17-27(33)22-28(30)34/h8-10,12-18,20,22,29,37H,3-7,11,19,21,23H2,1-2H3 |
| InChIKey | STLVHAHJVMODFB-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.72 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|