C26H32Cl2N4O2S — CID 5204859
N-[1-[4-(2,5-dichlorophenyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]octanamide (PubChem CID 5204859) has the molecular formula C26H32Cl2N4O2S and a molecular weight of 535.54 g/mol. Its IUPAC name is N-[1-[4-(2,5-dichlorophenyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]octanamide.
| Compound Name | N-[1-[4-(2,5-dichlorophenyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]octanamide |
|---|---|
| PubChem CID | 5204859 |
| Molecular Formula | C26H32Cl2N4O2S |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | N-[1-[4-(2,5-dichlorophenyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]octanamide |
| SMILES | CCCCCCCC(=O)NC(C)c1nnc(SCc2cccc(OC)c2)n1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C26H32Cl2N4O2S/c1-4-5-6-7-8-12-24(33)29-18(2)25-30-31-26(32(25)23-16-20(27)13-14-22(23)28)35-17-19-10-9-11-21(15-19)34-3/h9-11,13-16,18H,4-8,12,17H2,1-3H3,(H,29,33) |
| InChIKey | FTGKFLUEWATWSH-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|