C27H34Cl2N4OS — CID 42745985
N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]decanamide (PubChem CID 42745985) has the molecular formula C27H34Cl2N4OS and a molecular weight of 533.57 g/mol. Its IUPAC name is N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]decanamide.
| Compound Name | N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]decanamide |
|---|---|
| PubChem CID | 42745985 |
| Molecular Formula | C27H34Cl2N4OS |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | N-[1-[5-benzylsulfanyl-4-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NC(C)c1nnc(SCc2ccccc2)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H34Cl2N4OS/c1-3-4-5-6-7-8-12-15-25(34)30-20(2)26-31-32-27(35-19-21-13-10-9-11-14-21)33(26)24-17-16-22(28)18-23(24)29/h9-11,13-14,16-18,20H,3-8,12,15,19H2,1-2H3,(H,30,34) |
| InChIKey | FXULNCHCSBHJIF-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|