C23H29N3O3S — CID 39689571
3-(4-piperidin-1-ylsulfonylphenyl)-1-[(2R)-2-pyridin-3-ylpyrrolidin-1-yl]propan-1-one (PubChem CID 39689571) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 3-(4-piperidin-1-ylsulfonylphenyl)-1-[(2R)-2-pyridin-3-ylpyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(4-piperidin-1-ylsulfonylphenyl)-1-[(2R)-2-pyridin-3-ylpyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 39689571 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-(4-piperidin-1-ylsulfonylphenyl)-1-[(2R)-2-pyridin-3-ylpyrrolidin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)N1CCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C23H29N3O3S/c27-23(26-17-5-7-22(26)20-6-4-14-24-18-20)13-10-19-8-11-21(12-9-19)30(28,29)25-15-2-1-3-16-25/h4,6,8-9,11-12,14,18,22H,1-3,5,7,10,13,15-17H2/t22-/m1/s1 |
| InChIKey | MWGHQTFGZPNYFE-JOCHJYFZSA-N |
| XLogP | 3.55 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |