C15H16N2O4 — CID 39732445
8-(diethylamino)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid (PubChem CID 39732445) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 8-(diethylamino)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid.
| Compound Name | 8-(diethylamino)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 39732445 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 8-(diethylamino)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| SMILES | CCN(CC)c1c(C(=O)O)cnc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C15H16N2O4/c1-3-17(4-2)14-9-5-12-13(21-8-20-12)6-11(9)16-7-10(14)15(18)19/h5-7H,3-4,8H2,1-2H3,(H,18,19) |
| InChIKey | OCHNKOWNCMNOCO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |